C10H7F6N3O2 — CID 135753631
(Z)-1,1,1,5,5,5-hexafluoro-4-hydroxy-3-[(5-methyl-1H-pyrazol-3-yl)iminomethyl]pent-3-en-2-one (PubChem CID 135753631) has the molecular formula C10H7F6N3O2 and a molecular weight of 315.17 g/mol. Its IUPAC name is (Z)-1,1,1,5,5,5-hexafluoro-4-hydroxy-3-[(5-methyl-1H-pyrazol-3-yl)iminomethyl]pent-3-en-2-one.
| Compound Name | (Z)-1,1,1,5,5,5-hexafluoro-4-hydroxy-3-[(5-methyl-1H-pyrazol-3-yl)iminomethyl]pent-3-en-2-one |
|---|---|
| PubChem CID | 135753631 |
| Molecular Formula | C10H7F6N3O2 |
| Molecular Weight | 315.17 g/mol |
| Exact Mass | 315.04 |
| IUPAC Name | (Z)-1,1,1,5,5,5-hexafluoro-4-hydroxy-3-[(5-methyl-1H-pyrazol-3-yl)iminomethyl]pent-3-en-2-one |
| SMILES | Cc1cc(/N=C/C(C(=O)C(F)(F)F)=C(/O)C(F)(F)F)n[nH]1 |
| InChI | InChI=1S/C10H7F6N3O2/c1-4-2-6(19-18-4)17-3-5(7(20)9(11,12)13)8(21)10(14,15)16/h2-3,20H,1H3,(H,18,19)/b7-5-,17-3+ |
| InChIKey | LJRWHDWJSDFTGD-LTPYVXCESA-N |
| XLogP | 2.93 |
| TPSA | 78.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.17 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|