C18H22N3O3S+ — CID 135753643
N-[(2R)-2-(furan-2-yl)-2-piperidin-1-ium-1-ylethyl]-1,1-dioxo-1,2-benzothiazol-3-imine (PubChem CID 135753643) has the molecular formula C18H22N3O3S+ and a molecular weight of 360.46 g/mol. Its IUPAC name is N-[(2R)-2-(furan-2-yl)-2-piperidin-1-ium-1-ylethyl]-1,1-dioxo-1,2-benzothiazol-3-imine.
| Compound Name | N-[(2R)-2-(furan-2-yl)-2-piperidin-1-ium-1-ylethyl]-1,1-dioxo-1,2-benzothiazol-3-imine |
|---|---|
| PubChem CID | 135753643 |
| Molecular Formula | C18H22N3O3S+ |
| Molecular Weight | 360.46 g/mol |
| Exact Mass | 360.14 |
| IUPAC Name | N-[(2R)-2-(furan-2-yl)-2-piperidin-1-ium-1-ylethyl]-1,1-dioxo-1,2-benzothiazol-3-imine |
| SMILES | O=S1(=O)N/C(=N\C[C@H](c2ccco2)[NH+]2CCCCC2)c2ccccc21 |
| InChI | InChI=1S/C18H21N3O3S/c22-25(23)17-9-3-2-7-14(17)18(20-25)19-13-15(16-8-6-12-24-16)21-10-4-1-5-11-21/h2-3,6-9,12,15H,1,4-5,10-11,13H2,(H,19,20)/p+1/t15-/m1/s1 |
| InChIKey | DGCJVFVMPOMEKJ-OAHLLOKOSA-O |
| XLogP | 1.13 |
| TPSA | 76.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.46 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|