About 2-amino-9-(1,4-dihydroxybutyl)-7,8-dihydro-1H-purin-6-one
2-amino-9-(1,4-dihydroxybutyl)-7,8-dihydro-1H-purin-6-one (PubChem CID 135753904) has the molecular formula C9H15N5O3
and a molecular weight of 241.25 g/mol. Its IUPAC name is 2-amino-9-(1,4-dihydroxybutyl)-7,8-dihydro-1H-purin-6-one.
Molecular Properties
| Compound Name | 2-amino-9-(1,4-dihydroxybutyl)-7,8-dihydro-1H-purin-6-one |
| PubChem CID | 135753904 |
| Molecular Formula | C9H15N5O3 |
| Molecular Weight | 241.25 g/mol |
| Exact Mass | 241.12 |
| IUPAC Name | 2-amino-9-(1,4-dihydroxybutyl)-7,8-dihydro-1H-purin-6-one |
| SMILES | Nc1nc2c(c(=O)[nH]1)NCN2C(O)CCCO |
| InChI | InChI=1S/C9H15N5O3/c10-9-12-7-6(8(17)13-9)11-4-14(7)5(16)2-1-3-15/h5,11,15-16H,1-4H2,(H3,10,12,13,17) |
| InChIKey | KNGLLPCWQBDGJD-UHFFFAOYSA-N |
| XLogP | -1.37 |
| TPSA | 127.50 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.25 |
| LogP ≤ 5 | -1.37 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 2-amino-9-(1,4-dihydroxybutyl)-7,8-dihydro-1H-purin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-9-(1,4-dihydroxybutyl)-7,8-dihydro-1H-purin-6-one?
The IUPAC name of 2-amino-9-(1,4-dihydroxybutyl)-7,8-dihydro-1H-purin-6-one (CID 135753904) is 2-amino-9-(1,4-dihydroxybutyl)-7,8-dihydro-1H-purin-6-one.
What is the SMILES notation for 2-amino-9-(1,4-dihydroxybutyl)-7,8-dihydro-1H-purin-6-one?
The canonical SMILES for 2-amino-9-(1,4-dihydroxybutyl)-7,8-dihydro-1H-purin-6-one is Nc1nc2c(c(=O)[nH]1)NCN2C(O)CCCO.
What is the InChIKey of 2-amino-9-(1,4-dihydroxybutyl)-7,8-dihydro-1H-purin-6-one?
The InChIKey is KNGLLPCWQBDGJD-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15N5O3/c10-9-12-7-6(8(17)13-9)11-4-14(7)5(16)2-1-3-15/h5,11,15-16H,1-4H2,(H3,10,12,13,17).
What are the key properties of 2-amino-9-(1,4-dihydroxybutyl)-7,8-dihydro-1H-purin-6-one?
2-amino-9-(1,4-dihydroxybutyl)-7,8-dihydro-1H-purin-6-one has a molecular weight of 241.25 g/mol, XLogP of -1.37, 4 rotatable bonds, 5 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-9-(1,4-dihydroxybutyl)-7,8-dihydro-1H-purin-6-one is sourced from PubChem (CID 135753904), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).