C37H46Cl4N4O3 — CID 135754228
1-[4-chloro-3-[[5-oxo-1-(2,4,6-trichlorophenyl)pyrazolidin-3-ylidene]amino]phenyl]-3-[(E)-16-methylheptadec-5-enyl]pyrrolidine-2,5-dione (PubChem CID 135754228) has the molecular formula C37H46Cl4N4O3 and a molecular weight of 736.61 g/mol. Its IUPAC name is 1-[4-chloro-3-[[5-oxo-1-(2,4,6-trichlorophenyl)pyrazolidin-3-ylidene]amino]phenyl]-3-[(E)-16-methylheptadec-5-enyl]pyrrolidine-2,5-dione.
| Compound Name | 1-[4-chloro-3-[[5-oxo-1-(2,4,6-trichlorophenyl)pyrazolidin-3-ylidene]amino]phenyl]-3-[(E)-16-methylheptadec-5-enyl]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 135754228 |
| Molecular Formula | C37H46Cl4N4O3 |
| Molecular Weight | 736.61 g/mol |
| Exact Mass | 734.23 |
| IUPAC Name | 1-[4-chloro-3-[[5-oxo-1-(2,4,6-trichlorophenyl)pyrazolidin-3-ylidene]amino]phenyl]-3-[(E)-16-methylheptadec-5-enyl]pyrrolidine-2,5-dione |
| SMILES | CC(C)CCCCCCCCC/C=C/CCCCC1CC(=O)N(c2ccc(Cl)c(/N=C3\CC(=O)N(c4c(Cl)cc(Cl)cc4Cl)N3)c2)C1=O |
| InChI | InChI=1S/C37H46Cl4N4O3/c1-25(2)16-14-12-10-8-6-4-3-5-7-9-11-13-15-17-26-20-34(46)44(37(26)48)28-18-19-29(39)32(23-28)42-33-24-35(47)45(43-33)36-30(40)21-27(38)22-31(36)41/h7,9,18-19,21-23,25-26H,3-6,8,10-17,20,24H2,1-2H3,(H,42,43)/b9-7+ |
| InChIKey | GESORPIYJRUBLK-VQHVLOKHSA-N |
| XLogP | 11.43 |
| TPSA | 82.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 736.61 |
| LogP ≤ 5 | 11.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|