About N,N-dimethyl-6-methylimino-3,5-dihydropurin-2-amine
N,N-dimethyl-6-methylimino-3,5-dihydropurin-2-amine (PubChem CID 135754493) has the molecular formula C8H12N6
and a molecular weight of 192.23 g/mol. Its IUPAC name is N,N-dimethyl-6-methylimino-3,5-dihydropurin-2-amine.
Molecular Properties
| Compound Name | N,N-dimethyl-6-methylimino-3,5-dihydropurin-2-amine |
| PubChem CID | 135754493 |
| Molecular Formula | C8H12N6 |
| Molecular Weight | 192.23 g/mol |
| Exact Mass | 192.11 |
| IUPAC Name | N,N-dimethyl-6-methylimino-3,5-dihydropurin-2-amine |
| SMILES | C/N=C1\N=C(N(C)C)NC2=NC=NC21 |
| InChI | InChI=1S/C8H12N6/c1-9-6-5-7(11-4-10-5)13-8(12-6)14(2)3/h4-5H,1-3H3,(H,9,10,11,12,13) |
| InChIKey | WZKRMTAXKFEWLQ-UHFFFAOYSA-N |
| XLogP | -0.66 |
| TPSA | 64.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.23 |
| LogP ≤ 5 | -0.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze N,N-dimethyl-6-methylimino-3,5-dihydropurin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-dimethyl-6-methylimino-3,5-dihydropurin-2-amine?
The IUPAC name of N,N-dimethyl-6-methylimino-3,5-dihydropurin-2-amine (CID 135754493) is N,N-dimethyl-6-methylimino-3,5-dihydropurin-2-amine.
What is the SMILES notation for N,N-dimethyl-6-methylimino-3,5-dihydropurin-2-amine?
The canonical SMILES for N,N-dimethyl-6-methylimino-3,5-dihydropurin-2-amine is C/N=C1\N=C(N(C)C)NC2=NC=NC21.
What is the InChIKey of N,N-dimethyl-6-methylimino-3,5-dihydropurin-2-amine?
The InChIKey is WZKRMTAXKFEWLQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N6/c1-9-6-5-7(11-4-10-5)13-8(12-6)14(2)3/h4-5H,1-3H3,(H,9,10,11,12,13).
What are the key properties of N,N-dimethyl-6-methylimino-3,5-dihydropurin-2-amine?
N,N-dimethyl-6-methylimino-3,5-dihydropurin-2-amine has a molecular weight of 192.23 g/mol, XLogP of -0.66, 0 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dimethyl-6-methylimino-3,5-dihydropurin-2-amine is sourced from PubChem (CID 135754493), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).