About N-butyl-2-chloro-3,5-dihydropurin-6-imine
N-butyl-2-chloro-3,5-dihydropurin-6-imine (PubChem CID 135754497) has the molecular formula C9H12ClN5
and a molecular weight of 225.68 g/mol. Its IUPAC name is N-butyl-2-chloro-3,5-dihydropurin-6-imine.
Molecular Properties
| Compound Name | N-butyl-2-chloro-3,5-dihydropurin-6-imine |
| PubChem CID | 135754497 |
| Molecular Formula | C9H12ClN5 |
| Molecular Weight | 225.68 g/mol |
| Exact Mass | 225.08 |
| IUPAC Name | N-butyl-2-chloro-3,5-dihydropurin-6-imine |
| SMILES | CCCC/N=C1\N=C(Cl)NC2=NC=NC21 |
| InChI | InChI=1S/C9H12ClN5/c1-2-3-4-11-7-6-8(13-5-12-6)15-9(10)14-7/h5-6H,2-4H2,1H3,(H,11,12,13,14,15) |
| InChIKey | USFYQFYJPOTIGO-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 61.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.68 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze N-butyl-2-chloro-3,5-dihydropurin-6-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-butyl-2-chloro-3,5-dihydropurin-6-imine?
The IUPAC name of N-butyl-2-chloro-3,5-dihydropurin-6-imine (CID 135754497) is N-butyl-2-chloro-3,5-dihydropurin-6-imine.
What is the SMILES notation for N-butyl-2-chloro-3,5-dihydropurin-6-imine?
The canonical SMILES for N-butyl-2-chloro-3,5-dihydropurin-6-imine is CCCC/N=C1\N=C(Cl)NC2=NC=NC21.
What is the InChIKey of N-butyl-2-chloro-3,5-dihydropurin-6-imine?
The InChIKey is USFYQFYJPOTIGO-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12ClN5/c1-2-3-4-11-7-6-8(13-5-12-6)15-9(10)14-7/h5-6H,2-4H2,1H3,(H,11,12,13,14,15).
What are the key properties of N-butyl-2-chloro-3,5-dihydropurin-6-imine?
N-butyl-2-chloro-3,5-dihydropurin-6-imine has a molecular weight of 225.68 g/mol, XLogP of 1.19, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-butyl-2-chloro-3,5-dihydropurin-6-imine is sourced from PubChem (CID 135754497), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).