About 6-butylimino-3,5-dihydropurin-2-amine
6-butylimino-3,5-dihydropurin-2-amine (PubChem CID 135754503) has the molecular formula C9H14N6
and a molecular weight of 206.25 g/mol. Its IUPAC name is 6-butylimino-3,5-dihydropurin-2-amine.
Molecular Properties
| Compound Name | 6-butylimino-3,5-dihydropurin-2-amine |
| PubChem CID | 135754503 |
| Molecular Formula | C9H14N6 |
| Molecular Weight | 206.25 g/mol |
| Exact Mass | 206.13 |
| IUPAC Name | 6-butylimino-3,5-dihydropurin-2-amine |
| SMILES | CCCC/N=C1\N=C(N)NC2=NC=NC21 |
| InChI | InChI=1S/C9H14N6/c1-2-3-4-11-7-6-8(13-5-12-6)15-9(10)14-7/h5-6H,2-4H2,1H3,(H3,10,11,12,13,14,15) |
| InChIKey | AXGBNTURXHNRTH-UHFFFAOYSA-N |
| XLogP | -0.09 |
| TPSA | 87.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.25 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 6-butylimino-3,5-dihydropurin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-butylimino-3,5-dihydropurin-2-amine?
The IUPAC name of 6-butylimino-3,5-dihydropurin-2-amine (CID 135754503) is 6-butylimino-3,5-dihydropurin-2-amine.
What is the SMILES notation for 6-butylimino-3,5-dihydropurin-2-amine?
The canonical SMILES for 6-butylimino-3,5-dihydropurin-2-amine is CCCC/N=C1\N=C(N)NC2=NC=NC21.
What is the InChIKey of 6-butylimino-3,5-dihydropurin-2-amine?
The InChIKey is AXGBNTURXHNRTH-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14N6/c1-2-3-4-11-7-6-8(13-5-12-6)15-9(10)14-7/h5-6H,2-4H2,1H3,(H3,10,11,12,13,14,15).
What are the key properties of 6-butylimino-3,5-dihydropurin-2-amine?
6-butylimino-3,5-dihydropurin-2-amine has a molecular weight of 206.25 g/mol, XLogP of -0.09, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-butylimino-3,5-dihydropurin-2-amine is sourced from PubChem (CID 135754503), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).