About N,8-dimethyl-5,9-dihydropurin-6-imine
N,8-dimethyl-5,9-dihydropurin-6-imine (PubChem CID 135754531) has the molecular formula C7H9N5
and a molecular weight of 163.18 g/mol. Its IUPAC name is N,8-dimethyl-5,9-dihydropurin-6-imine.
Molecular Properties
| Compound Name | N,8-dimethyl-5,9-dihydropurin-6-imine |
| PubChem CID | 135754531 |
| Molecular Formula | C7H9N5 |
| Molecular Weight | 163.18 g/mol |
| Exact Mass | 163.09 |
| IUPAC Name | N,8-dimethyl-5,9-dihydropurin-6-imine |
| SMILES | C/N=C1\N=CN=C2NC(C)=NC21 |
| InChI | InChI=1S/C7H9N5/c1-4-11-5-6(8-2)9-3-10-7(5)12-4/h3,5H,1-2H3,(H,8,9,10,11,12) |
| InChIKey | UCIWFBWNQWKOCU-UHFFFAOYSA-N |
| XLogP | -0.15 |
| TPSA | 61.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.18 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze N,8-dimethyl-5,9-dihydropurin-6-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,8-dimethyl-5,9-dihydropurin-6-imine?
The IUPAC name of N,8-dimethyl-5,9-dihydropurin-6-imine (CID 135754531) is N,8-dimethyl-5,9-dihydropurin-6-imine.
What is the SMILES notation for N,8-dimethyl-5,9-dihydropurin-6-imine?
The canonical SMILES for N,8-dimethyl-5,9-dihydropurin-6-imine is C/N=C1\N=CN=C2NC(C)=NC21.
What is the InChIKey of N,8-dimethyl-5,9-dihydropurin-6-imine?
The InChIKey is UCIWFBWNQWKOCU-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9N5/c1-4-11-5-6(8-2)9-3-10-7(5)12-4/h3,5H,1-2H3,(H,8,9,10,11,12).
What are the key properties of N,8-dimethyl-5,9-dihydropurin-6-imine?
N,8-dimethyl-5,9-dihydropurin-6-imine has a molecular weight of 163.18 g/mol, XLogP of -0.15, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N,8-dimethyl-5,9-dihydropurin-6-imine is sourced from PubChem (CID 135754531), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).