About 8-amino-3,5-dihydropurine-2,6-dione
8-amino-3,5-dihydropurine-2,6-dione (PubChem CID 135754539) has the molecular formula C5H5N5O2
and a molecular weight of 167.13 g/mol. Its IUPAC name is 8-amino-3,5-dihydropurine-2,6-dione.
Molecular Properties
| Compound Name | 8-amino-3,5-dihydropurine-2,6-dione |
| PubChem CID | 135754539 |
| Molecular Formula | C5H5N5O2 |
| Molecular Weight | 167.13 g/mol |
| Exact Mass | 167.04 |
| IUPAC Name | 8-amino-3,5-dihydropurine-2,6-dione |
| SMILES | NC1=NC2C(=O)NC(=O)NC2=N1 |
| InChI | InChI=1S/C5H5N5O2/c6-4-7-1-2(8-4)9-5(12)10-3(1)11/h1H,(H4,6,7,8,9,10,11,12) |
| InChIKey | PMFRALVQKDUCKL-UHFFFAOYSA-N |
| XLogP | -2.08 |
| TPSA | 108.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.13 |
| LogP ≤ 5 | -2.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 8-amino-3,5-dihydropurine-2,6-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-amino-3,5-dihydropurine-2,6-dione?
The IUPAC name of 8-amino-3,5-dihydropurine-2,6-dione (CID 135754539) is 8-amino-3,5-dihydropurine-2,6-dione.
What is the SMILES notation for 8-amino-3,5-dihydropurine-2,6-dione?
The canonical SMILES for 8-amino-3,5-dihydropurine-2,6-dione is NC1=NC2C(=O)NC(=O)NC2=N1.
What is the InChIKey of 8-amino-3,5-dihydropurine-2,6-dione?
The InChIKey is PMFRALVQKDUCKL-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H5N5O2/c6-4-7-1-2(8-4)9-5(12)10-3(1)11/h1H,(H4,6,7,8,9,10,11,12).
What are the key properties of 8-amino-3,5-dihydropurine-2,6-dione?
8-amino-3,5-dihydropurine-2,6-dione has a molecular weight of 167.13 g/mol, XLogP of -2.08, 0 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 8-amino-3,5-dihydropurine-2,6-dione is sourced from PubChem (CID 135754539), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).