About 2-[4-hydroxy-5-(2-methylpropyliminomethyl)-2-sulfanylidene-1,3-thiazol-3-yl]acetic acid
2-[4-hydroxy-5-(2-methylpropyliminomethyl)-2-sulfanylidene-1,3-thiazol-3-yl]acetic acid (PubChem CID 135754914) has the molecular formula C10H14N2O3S2
and a molecular weight of 274.37 g/mol. Its IUPAC name is 2-[4-hydroxy-5-(2-methylpropyliminomethyl)-2-sulfanylidene-1,3-thiazol-3-yl]acetic acid.
Molecular Properties
| Compound Name | 2-[4-hydroxy-5-(2-methylpropyliminomethyl)-2-sulfanylidene-1,3-thiazol-3-yl]acetic acid |
| PubChem CID | 135754914 |
| Molecular Formula | C10H14N2O3S2 |
| Molecular Weight | 274.37 g/mol |
| Exact Mass | 274.04 |
| IUPAC Name | 2-[4-hydroxy-5-(2-methylpropyliminomethyl)-2-sulfanylidene-1,3-thiazol-3-yl]acetic acid |
| SMILES | CC(C)C/N=C/c1sc(=S)n(CC(=O)O)c1O |
| InChI | InChI=1S/C10H14N2O3S2/c1-6(2)3-11-4-7-9(15)12(5-8(13)14)10(16)17-7/h4,6,15H,3,5H2,1-2H3,(H,13,14)/b11-4+ |
| InChIKey | HVPGCRBTRPOVHZ-NYYWCZLTSA-N |
| XLogP | 2.14 |
| TPSA | 74.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.37 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 2-[4-hydroxy-5-(2-methylpropyliminomethyl)-2-sulfanylidene-1,3-thiazol-3-yl]acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-hydroxy-5-(2-methylpropyliminomethyl)-2-sulfanylidene-1,3-thiazol-3-yl]acetic acid?
The IUPAC name of 2-[4-hydroxy-5-(2-methylpropyliminomethyl)-2-sulfanylidene-1,3-thiazol-3-yl]acetic acid (CID 135754914) is 2-[4-hydroxy-5-(2-methylpropyliminomethyl)-2-sulfanylidene-1,3-thiazol-3-yl]acetic acid.
What is the SMILES notation for 2-[4-hydroxy-5-(2-methylpropyliminomethyl)-2-sulfanylidene-1,3-thiazol-3-yl]acetic acid?
The canonical SMILES for 2-[4-hydroxy-5-(2-methylpropyliminomethyl)-2-sulfanylidene-1,3-thiazol-3-yl]acetic acid is CC(C)C/N=C/c1sc(=S)n(CC(=O)O)c1O.
What is the InChIKey of 2-[4-hydroxy-5-(2-methylpropyliminomethyl)-2-sulfanylidene-1,3-thiazol-3-yl]acetic acid?
The InChIKey is HVPGCRBTRPOVHZ-NYYWCZLTSA-N. The full InChI is InChI=1S/C10H14N2O3S2/c1-6(2)3-11-4-7-9(15)12(5-8(13)14)10(16)17-7/h4,6,15H,3,5H2,1-2H3,(H,13,14)/b11-4+.
What are the key properties of 2-[4-hydroxy-5-(2-methylpropyliminomethyl)-2-sulfanylidene-1,3-thiazol-3-yl]acetic acid?
2-[4-hydroxy-5-(2-methylpropyliminomethyl)-2-sulfanylidene-1,3-thiazol-3-yl]acetic acid has a molecular weight of 274.37 g/mol, XLogP of 2.14, 5 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-hydroxy-5-(2-methylpropyliminomethyl)-2-sulfanylidene-1,3-thiazol-3-yl]acetic acid is sourced from PubChem (CID 135754914), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).