About 2-amino-9-(2-hydroxyethoxymethyl)-7-methyl-1,8-dihydropurin-6-one iodide
2-amino-9-(2-hydroxyethoxymethyl)-7-methyl-1,8-dihydropurin-6-one iodide (PubChem CID 135754930) has the molecular formula C9H15IN5O3-
and a molecular weight of 368.16 g/mol. Its IUPAC name is 2-amino-9-(2-hydroxyethoxymethyl)-7-methyl-1,8-dihydropurin-6-one iodide.
Molecular Properties
| Compound Name | 2-amino-9-(2-hydroxyethoxymethyl)-7-methyl-1,8-dihydropurin-6-one iodide |
| PubChem CID | 135754930 |
| Molecular Formula | C9H15IN5O3- |
| Molecular Weight | 368.16 g/mol |
| Exact Mass | 368.02 |
| IUPAC Name | 2-amino-9-(2-hydroxyethoxymethyl)-7-methyl-1,8-dihydropurin-6-one iodide |
| SMILES | CN1CN(COCCO)c2nc(N)[nH]c(=O)c21.[I-] |
| InChI | InChI=1S/C9H15N5O3.HI/c1-13-4-14(5-17-3-2-15)7-6(13)8(16)12-9(10)11-7;/h15H,2-5H2,1H3,(H3,10,11,12,16);1H/p-1 |
| InChIKey | GIPKSOHURTUQLI-UHFFFAOYSA-M |
| XLogP | -4.46 |
| TPSA | 107.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 368.16 |
| LogP ≤ 5 | -4.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 2-amino-9-(2-hydroxyethoxymethyl)-7-methyl-1,8-dihydropurin-6-one iodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-9-(2-hydroxyethoxymethyl)-7-methyl-1,8-dihydropurin-6-one iodide?
The IUPAC name of 2-amino-9-(2-hydroxyethoxymethyl)-7-methyl-1,8-dihydropurin-6-one iodide (CID 135754930) is 2-amino-9-(2-hydroxyethoxymethyl)-7-methyl-1,8-dihydropurin-6-one iodide.
What is the SMILES notation for 2-amino-9-(2-hydroxyethoxymethyl)-7-methyl-1,8-dihydropurin-6-one iodide?
The canonical SMILES for 2-amino-9-(2-hydroxyethoxymethyl)-7-methyl-1,8-dihydropurin-6-one iodide is CN1CN(COCCO)c2nc(N)[nH]c(=O)c21.[I-].
What is the InChIKey of 2-amino-9-(2-hydroxyethoxymethyl)-7-methyl-1,8-dihydropurin-6-one iodide?
The InChIKey is GIPKSOHURTUQLI-UHFFFAOYSA-M. The full InChI is InChI=1S/C9H15N5O3.HI/c1-13-4-14(5-17-3-2-15)7-6(13)8(16)12-9(10)11-7;/h15H,2-5H2,1H3,(H3,10,11,12,16);1H/p-1.
What are the key properties of 2-amino-9-(2-hydroxyethoxymethyl)-7-methyl-1,8-dihydropurin-6-one iodide?
2-amino-9-(2-hydroxyethoxymethyl)-7-methyl-1,8-dihydropurin-6-one iodide has a molecular weight of 368.16 g/mol, XLogP of -4.46, 4 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-9-(2-hydroxyethoxymethyl)-7-methyl-1,8-dihydropurin-6-one iodide is sourced from PubChem (CID 135754930), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).