C7H7N5O3 — CID 135755320
2-amino-8-methyl-3,5-dihydropteridine-4,6,7-trione (PubChem CID 135755320) has the molecular formula C7H7N5O3 and a molecular weight of 209.16 g/mol. Its IUPAC name is 2-amino-8-methyl-3,5-dihydropteridine-4,6,7-trione.
| Compound Name | 2-amino-8-methyl-3,5-dihydropteridine-4,6,7-trione |
|---|---|
| PubChem CID | 135755320 |
| Molecular Formula | C7H7N5O3 |
| Molecular Weight | 209.16 g/mol |
| Exact Mass | 209.05 |
| IUPAC Name | 2-amino-8-methyl-3,5-dihydropteridine-4,6,7-trione |
| SMILES | Cn1c(=O)c(=O)[nH]c2c(=O)[nH]c(N)nc21 |
| InChI | InChI=1S/C7H7N5O3/c1-12-3-2(9-5(14)6(12)15)4(13)11-7(8)10-3/h1H3,(H,9,14)(H3,8,10,11,13) |
| InChIKey | KXFRJQFMYRMWEL-UHFFFAOYSA-N |
| XLogP | -2.11 |
| TPSA | 126.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.16 |
| LogP ≤ 5 | -2.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|