About quinoline-5-thiol
quinoline-5-thiol (PubChem CID 135755324) has the molecular formula C9H7NS
and a molecular weight of 161.23 g/mol. Its IUPAC name is quinoline-5-thiol.
Molecular Properties
| Compound Name | quinoline-5-thiol |
| PubChem CID | 135755324 |
| Molecular Formula | C9H7NS |
| Molecular Weight | 161.23 g/mol |
| Exact Mass | 161.03 |
| IUPAC Name | quinoline-5-thiol |
| SMILES | Sc1cccc2ncccc12 |
| InChI | InChI=1S/C9H7NS/c11-9-5-1-4-8-7(9)3-2-6-10-8/h1-6,11H |
| InChIKey | XAXWWYIMGUQNMY-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 12.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 161.23 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze quinoline-5-thiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of quinoline-5-thiol?
The IUPAC name of quinoline-5-thiol (CID 135755324) is quinoline-5-thiol.
What is the SMILES notation for quinoline-5-thiol?
The canonical SMILES for quinoline-5-thiol is Sc1cccc2ncccc12.
What is the InChIKey of quinoline-5-thiol?
The InChIKey is XAXWWYIMGUQNMY-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7NS/c11-9-5-1-4-8-7(9)3-2-6-10-8/h1-6,11H.
What are the key properties of quinoline-5-thiol?
quinoline-5-thiol has a molecular weight of 161.23 g/mol, XLogP of 2.52, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for quinoline-5-thiol is sourced from PubChem (CID 135755324), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).