C6H8N4O — CID 135755335
5,6,7,8-tetrahydro-3H-pteridin-4-one (PubChem CID 135755335) has the molecular formula C6H8N4O and a molecular weight of 152.16 g/mol. Its IUPAC name is 5,6,7,8-tetrahydro-3H-pteridin-4-one.
| Compound Name | 5,6,7,8-tetrahydro-3H-pteridin-4-one |
|---|---|
| PubChem CID | 135755335 |
| Molecular Formula | C6H8N4O |
| Molecular Weight | 152.16 g/mol |
| Exact Mass | 152.07 |
| IUPAC Name | 5,6,7,8-tetrahydro-3H-pteridin-4-one |
| SMILES | O=c1[nH]cnc2c1NCCN2 |
| InChI | InChI=1S/C6H8N4O/c11-6-4-5(9-3-10-6)8-2-1-7-4/h3,7H,1-2H2,(H2,8,9,10,11) |
| InChIKey | YMYLCENGLBCRLP-UHFFFAOYSA-N |
| XLogP | -0.39 |
| TPSA | 69.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.16 |
| LogP ≤ 5 | -0.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |