C23H14BrN3O2 — CID 135757484
3-(4-bromophenyl)-2-[(Z)-(2-oxo-1H-indol-3-ylidene)methyl]quinazolin-4-one (PubChem CID 135757484) has the molecular formula C23H14BrN3O2 and a molecular weight of 444.29 g/mol. Its IUPAC name is 3-(4-bromophenyl)-2-[(Z)-(2-oxo-1H-indol-3-ylidene)methyl]quinazolin-4-one.
| Compound Name | 3-(4-bromophenyl)-2-[(Z)-(2-oxo-1H-indol-3-ylidene)methyl]quinazolin-4-one |
|---|---|
| PubChem CID | 135757484 |
| Molecular Formula | C23H14BrN3O2 |
| Molecular Weight | 444.29 g/mol |
| Exact Mass | 443.03 |
| IUPAC Name | 3-(4-bromophenyl)-2-[(Z)-(2-oxo-1H-indol-3-ylidene)methyl]quinazolin-4-one |
| SMILES | O=C1Nc2ccccc2/C1=C/c1nc2ccccc2c(=O)n1-c1ccc(Br)cc1 |
| InChI | InChI=1S/C23H14BrN3O2/c24-14-9-11-15(12-10-14)27-21(25-20-8-4-2-6-17(20)23(27)29)13-18-16-5-1-3-7-19(16)26-22(18)28/h1-13H,(H,26,28)/b18-13- |
| InChIKey | WUKFKUYQNDHWIO-AQTBWJFISA-N |
| XLogP | 4.64 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.29 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|