C21H24ClNO4 — CID 135757708
(Z,2S,3R,4R)-8-(2-chloro-4-hydroxyphenyl)-3-ethenyl-7-pyridin-2-yloct-7-ene-1,2,4-triol (PubChem CID 135757708) has the molecular formula C21H24ClNO4 and a molecular weight of 389.88 g/mol. Its IUPAC name is (Z,2S,3R,4R)-8-(2-chloro-4-hydroxyphenyl)-3-ethenyl-7-pyridin-2-yloct-7-ene-1,2,4-triol.
| Compound Name | (Z,2S,3R,4R)-8-(2-chloro-4-hydroxyphenyl)-3-ethenyl-7-pyridin-2-yloct-7-ene-1,2,4-triol |
|---|---|
| PubChem CID | 135757708 |
| Molecular Formula | C21H24ClNO4 |
| Molecular Weight | 389.88 g/mol |
| Exact Mass | 389.14 |
| IUPAC Name | (Z,2S,3R,4R)-8-(2-chloro-4-hydroxyphenyl)-3-ethenyl-7-pyridin-2-yloct-7-ene-1,2,4-triol |
| SMILES | C=C[C@@H]([C@H](O)CO)[C@H](O)CC/C(=C/c1ccc(O)cc1Cl)c1ccccn1 |
| InChI | InChI=1S/C21H24ClNO4/c1-2-17(21(27)13-24)20(26)9-7-15(19-5-3-4-10-23-19)11-14-6-8-16(25)12-18(14)22/h2-6,8,10-12,17,20-21,24-27H,1,7,9,13H2/b15-11-/t17-,20-,21-/m1/s1 |
| InChIKey | RUFZKHOZBZBEMC-CWUVYDJMSA-N |
| XLogP | 3.28 |
| TPSA | 93.81 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.88 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|