C15H14N4S — CID 135759050
N-[(Z)-(5-phenyl-3,6-dihydro-1,3,4-thiadiazin-2-ylidene)amino]aniline (PubChem CID 135759050) has the molecular formula C15H14N4S and a molecular weight of 282.37 g/mol. Its IUPAC name is N-[(Z)-(5-phenyl-3,6-dihydro-1,3,4-thiadiazin-2-ylidene)amino]aniline.
| Compound Name | N-[(Z)-(5-phenyl-3,6-dihydro-1,3,4-thiadiazin-2-ylidene)amino]aniline |
|---|---|
| PubChem CID | 135759050 |
| Molecular Formula | C15H14N4S |
| Molecular Weight | 282.37 g/mol |
| Exact Mass | 282.09 |
| IUPAC Name | N-[(Z)-(5-phenyl-3,6-dihydro-1,3,4-thiadiazin-2-ylidene)amino]aniline |
| SMILES | c1ccc(N/N=C2/NN=C(c3ccccc3)CS2)cc1 |
| InChI | InChI=1S/C15H14N4S/c1-3-7-12(8-4-1)14-11-20-15(19-17-14)18-16-13-9-5-2-6-10-13/h1-10,16H,11H2,(H,18,19) |
| InChIKey | ZSLYYOHSHWQZJF-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 48.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.37 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|