C16H19FN6O — CID 135759113
7-fluoro-2-methyl-4-(4-methyl-4-oxidopiperazin-4-ium-1-yl)-10H-pyrazolo[3,4-b][1,5]benzodiazepine (PubChem CID 135759113) has the molecular formula C16H19FN6O and a molecular weight of 330.37 g/mol. Its IUPAC name is 7-fluoro-2-methyl-4-(4-methyl-4-oxidopiperazin-4-ium-1-yl)-10H-pyrazolo[3,4-b][1,5]benzodiazepine.
| Compound Name | 7-fluoro-2-methyl-4-(4-methyl-4-oxidopiperazin-4-ium-1-yl)-10H-pyrazolo[3,4-b][1,5]benzodiazepine |
|---|---|
| PubChem CID | 135759113 |
| Molecular Formula | C16H19FN6O |
| Molecular Weight | 330.37 g/mol |
| Exact Mass | 330.16 |
| IUPAC Name | 7-fluoro-2-methyl-4-(4-methyl-4-oxidopiperazin-4-ium-1-yl)-10H-pyrazolo[3,4-b][1,5]benzodiazepine |
| SMILES | Cn1cc2c(n1)Nc1ccc(F)cc1N=C2N1CC[N+](C)([O-])CC1 |
| InChI | InChI=1S/C16H19FN6O/c1-21-10-12-15(20-21)18-13-4-3-11(17)9-14(13)19-16(12)22-5-7-23(2,24)8-6-22/h3-4,9-10H,5-8H2,1-2H3,(H,18,20) |
| InChIKey | ODDAGPPBKZRYEU-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 68.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.37 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|