C10H13N5O2 — CID 135759448
(2R,3S)-1-(6-imino-7H-purin-3-yl)pent-4-ene-2,3-diol (PubChem CID 135759448) has the molecular formula C10H13N5O2 and a molecular weight of 235.25 g/mol. Its IUPAC name is (2R,3S)-1-(6-imino-7H-purin-3-yl)pent-4-ene-2,3-diol.
| Compound Name | (2R,3S)-1-(6-imino-7H-purin-3-yl)pent-4-ene-2,3-diol |
|---|---|
| PubChem CID | 135759448 |
| Molecular Formula | C10H13N5O2 |
| Molecular Weight | 235.25 g/mol |
| Exact Mass | 235.11 |
| IUPAC Name | (2R,3S)-1-(6-imino-7H-purin-3-yl)pent-4-ene-2,3-diol |
| SMILES | [H]/N=c1\ncn(C[C@@H](O)[C@@H](O)C=C)c2nc[nH]c12 |
| InChI | InChI=1S/C10H13N5O2/c1-2-6(16)7(17)3-15-5-14-9(11)8-10(15)13-4-12-8/h2,4-7,11,16-17H,1,3H2,(H,12,13)/b11-9-/t6-,7+/m0/s1 |
| InChIKey | FFYUBBSCNMWQJY-ASUSWUQDSA-N |
| XLogP | -0.85 |
| TPSA | 110.81 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.25 |
| LogP ≤ 5 | -0.85 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|