C17H10ClN2O3S- — CID 135759535
3-[(E)-[2-(2-chlorophenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]benzoate (PubChem CID 135759535) has the molecular formula C17H10ClN2O3S- and a molecular weight of 357.80 g/mol. Its IUPAC name is 3-[(E)-[2-(2-chlorophenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]benzoate.
| Compound Name | 3-[(E)-[2-(2-chlorophenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]benzoate |
|---|---|
| PubChem CID | 135759535 |
| Molecular Formula | C17H10ClN2O3S- |
| Molecular Weight | 357.80 g/mol |
| Exact Mass | 357.01 |
| IUPAC Name | 3-[(E)-[2-(2-chlorophenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]benzoate |
| SMILES | O=C1N/C(=N/c2ccccc2Cl)S/C1=C/c1cccc(C(=O)[O-])c1 |
| InChI | InChI=1S/C17H11ClN2O3S/c18-12-6-1-2-7-13(12)19-17-20-15(21)14(24-17)9-10-4-3-5-11(8-10)16(22)23/h1-9H,(H,22,23)(H,19,20,21)/p-1/b14-9+ |
| InChIKey | YDLJPHPKRGHXSO-NTEUORMPSA-M |
| XLogP | 2.60 |
| TPSA | 81.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.80 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|