C23H29NO3 — CID 135760165
(Z,2R,3S,4R)-3-ethenyl-8-(4-hydroxy-3,5-dimethylphenyl)-7-pyridin-2-yloct-7-ene-2,4-diol (PubChem CID 135760165) has the molecular formula C23H29NO3 and a molecular weight of 367.49 g/mol. Its IUPAC name is (Z,2R,3S,4R)-3-ethenyl-8-(4-hydroxy-3,5-dimethylphenyl)-7-pyridin-2-yloct-7-ene-2,4-diol.
| Compound Name | (Z,2R,3S,4R)-3-ethenyl-8-(4-hydroxy-3,5-dimethylphenyl)-7-pyridin-2-yloct-7-ene-2,4-diol |
|---|---|
| PubChem CID | 135760165 |
| Molecular Formula | C23H29NO3 |
| Molecular Weight | 367.49 g/mol |
| Exact Mass | 367.21 |
| IUPAC Name | (Z,2R,3S,4R)-3-ethenyl-8-(4-hydroxy-3,5-dimethylphenyl)-7-pyridin-2-yloct-7-ene-2,4-diol |
| SMILES | C=C[C@H]([C@H](O)CC/C(=C/c1cc(C)c(O)c(C)c1)c1ccccn1)[C@@H](C)O |
| InChI | InChI=1S/C23H29NO3/c1-5-20(17(4)25)22(26)10-9-19(21-8-6-7-11-24-21)14-18-12-15(2)23(27)16(3)13-18/h5-8,11-14,17,20,22,25-27H,1,9-10H2,2-4H3/b19-14-/t17-,20+,22-/m1/s1 |
| InChIKey | ROYQOLWYPPNLEG-XMVCOJITSA-N |
| XLogP | 4.27 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.49 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|