C22H20N2O4 — CID 135760521
2-[5-(furan-2-yl)-7-methoxy-5,10b-dihydro-1H-pyrazolo[1,5-c][1,3]benzoxazin-2-yl]-4-methylphenol (PubChem CID 135760521) has the molecular formula C22H20N2O4 and a molecular weight of 376.41 g/mol. Its IUPAC name is 2-[5-(furan-2-yl)-7-methoxy-5,10b-dihydro-1H-pyrazolo[1,5-c][1,3]benzoxazin-2-yl]-4-methylphenol.
| Compound Name | 2-[5-(furan-2-yl)-7-methoxy-5,10b-dihydro-1H-pyrazolo[1,5-c][1,3]benzoxazin-2-yl]-4-methylphenol |
|---|---|
| PubChem CID | 135760521 |
| Molecular Formula | C22H20N2O4 |
| Molecular Weight | 376.41 g/mol |
| Exact Mass | 376.14 |
| IUPAC Name | 2-[5-(furan-2-yl)-7-methoxy-5,10b-dihydro-1H-pyrazolo[1,5-c][1,3]benzoxazin-2-yl]-4-methylphenol |
| SMILES | COc1cccc2c1OC(c1ccco1)N1N=C(c3cc(C)ccc3O)CC21 |
| InChI | InChI=1S/C22H20N2O4/c1-13-8-9-18(25)15(11-13)16-12-17-14-5-3-6-19(26-2)21(14)28-22(24(17)23-16)20-7-4-10-27-20/h3-11,17,22,25H,12H2,1-2H3 |
| InChIKey | GZAQNVKHLVZTIJ-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.41 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'} |
|---|