C12H12N4O3 — CID 135760934
methyl 2-[(6-methyl-5-oxo-4H-1,2,4-triazin-3-yl)amino]benzoate (PubChem CID 135760934) has the molecular formula C12H12N4O3 and a molecular weight of 260.25 g/mol. Its IUPAC name is methyl 2-[(6-methyl-5-oxo-4H-1,2,4-triazin-3-yl)amino]benzoate.
| Compound Name | methyl 2-[(6-methyl-5-oxo-4H-1,2,4-triazin-3-yl)amino]benzoate |
|---|---|
| PubChem CID | 135760934 |
| Molecular Formula | C12H12N4O3 |
| Molecular Weight | 260.25 g/mol |
| Exact Mass | 260.09 |
| IUPAC Name | methyl 2-[(6-methyl-5-oxo-4H-1,2,4-triazin-3-yl)amino]benzoate |
| SMILES | COC(=O)c1ccccc1Nc1nnc(C)c(=O)[nH]1 |
| InChI | InChI=1S/C12H12N4O3/c1-7-10(17)14-12(16-15-7)13-9-6-4-3-5-8(9)11(18)19-2/h3-6H,1-2H3,(H2,13,14,16,17) |
| InChIKey | AFGVZHBQJDHVJW-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.25 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |