C20H20N2O2S2 — CID 135761598
(2S)-N-(furan-2-ylmethyl)-3-oxo-2-(4-propylpyridin-1-ium-1-yl)-3-thiophen-2-ylpropanimidothioate (PubChem CID 135761598) has the molecular formula C20H20N2O2S2 and a molecular weight of 384.53 g/mol. Its IUPAC name is (2S)-N-(furan-2-ylmethyl)-3-oxo-2-(4-propylpyridin-1-ium-1-yl)-3-thiophen-2-ylpropanimidothioate.
| Compound Name | (2S)-N-(furan-2-ylmethyl)-3-oxo-2-(4-propylpyridin-1-ium-1-yl)-3-thiophen-2-ylpropanimidothioate |
|---|---|
| PubChem CID | 135761598 |
| Molecular Formula | C20H20N2O2S2 |
| Molecular Weight | 384.53 g/mol |
| Exact Mass | 384.10 |
| IUPAC Name | (2S)-N-(furan-2-ylmethyl)-3-oxo-2-(4-propylpyridin-1-ium-1-yl)-3-thiophen-2-ylpropanimidothioate |
| SMILES | CCCc1cc[n+]([C@@H](C(=O)c2cccs2)/C([S-])=N/Cc2ccco2)cc1 |
| InChI | InChI=1S/C20H20N2O2S2/c1-2-5-15-8-10-22(11-9-15)18(19(23)17-7-4-13-26-17)20(25)21-14-16-6-3-12-24-16/h3-4,6-13,18H,2,5,14H2,1H3/t18-/m0/s1 |
| InChIKey | NRRQSESVHHTFJL-SFHVURJKSA-N |
| XLogP | 4.15 |
| TPSA | 46.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.53 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|