About 2-amino-9-(2-hydroxyethoxymethyl)-7,8-dihydro-1H-purin-6-one
2-amino-9-(2-hydroxyethoxymethyl)-7,8-dihydro-1H-purin-6-one (PubChem CID 135761770) has the molecular formula C8H13N5O3
and a molecular weight of 227.22 g/mol. Its IUPAC name is 2-amino-9-(2-hydroxyethoxymethyl)-7,8-dihydro-1H-purin-6-one.
Molecular Properties
| Compound Name | 2-amino-9-(2-hydroxyethoxymethyl)-7,8-dihydro-1H-purin-6-one |
| PubChem CID | 135761770 |
| Molecular Formula | C8H13N5O3 |
| Molecular Weight | 227.22 g/mol |
| Exact Mass | 227.10 |
| IUPAC Name | 2-amino-9-(2-hydroxyethoxymethyl)-7,8-dihydro-1H-purin-6-one |
| SMILES | Nc1nc2c(c(=O)[nH]1)NCN2COCCO |
| InChI | InChI=1S/C8H13N5O3/c9-8-11-6-5(7(15)12-8)10-3-13(6)4-16-2-1-14/h10,14H,1-4H2,(H3,9,11,12,15) |
| InChIKey | VPBCCDFYEBLCBA-UHFFFAOYSA-N |
| XLogP | -1.49 |
| TPSA | 116.50 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.22 |
| LogP ≤ 5 | -1.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-amino-9-(2-hydroxyethoxymethyl)-7,8-dihydro-1H-purin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-9-(2-hydroxyethoxymethyl)-7,8-dihydro-1H-purin-6-one?
The IUPAC name of 2-amino-9-(2-hydroxyethoxymethyl)-7,8-dihydro-1H-purin-6-one (CID 135761770) is 2-amino-9-(2-hydroxyethoxymethyl)-7,8-dihydro-1H-purin-6-one.
What is the SMILES notation for 2-amino-9-(2-hydroxyethoxymethyl)-7,8-dihydro-1H-purin-6-one?
The canonical SMILES for 2-amino-9-(2-hydroxyethoxymethyl)-7,8-dihydro-1H-purin-6-one is Nc1nc2c(c(=O)[nH]1)NCN2COCCO.
What is the InChIKey of 2-amino-9-(2-hydroxyethoxymethyl)-7,8-dihydro-1H-purin-6-one?
The InChIKey is VPBCCDFYEBLCBA-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13N5O3/c9-8-11-6-5(7(15)12-8)10-3-13(6)4-16-2-1-14/h10,14H,1-4H2,(H3,9,11,12,15).
What are the key properties of 2-amino-9-(2-hydroxyethoxymethyl)-7,8-dihydro-1H-purin-6-one?
2-amino-9-(2-hydroxyethoxymethyl)-7,8-dihydro-1H-purin-6-one has a molecular weight of 227.22 g/mol, XLogP of -1.49, 4 rotatable bonds, 4 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-9-(2-hydroxyethoxymethyl)-7,8-dihydro-1H-purin-6-one is sourced from PubChem (CID 135761770), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).