About 5-[3-(1H-imidazol-2-yl)-6-phenyl-1,7-dihydroindazol-6-yl]-1,3-thiazole
5-[3-(1H-imidazol-2-yl)-6-phenyl-1,7-dihydroindazol-6-yl]-1,3-thiazole (PubChem CID 135761808) has the molecular formula C19H15N5S
and a molecular weight of 345.43 g/mol. Its IUPAC name is 5-[3-(1H-imidazol-2-yl)-6-phenyl-1,7-dihydroindazol-6-yl]-1,3-thiazole.
Molecular Properties
| Compound Name | 5-[3-(1H-imidazol-2-yl)-6-phenyl-1,7-dihydroindazol-6-yl]-1,3-thiazole |
| PubChem CID | 135761808 |
| Molecular Formula | C19H15N5S |
| Molecular Weight | 345.43 g/mol |
| Exact Mass | 345.10 |
| IUPAC Name | 5-[3-(1H-imidazol-2-yl)-6-phenyl-1,7-dihydroindazol-6-yl]-1,3-thiazole |
| SMILES | C1=CC(c2ccccc2)(c2cncs2)Cc2[nH]nc(-c3ncc[nH]3)c21 |
| InChI | InChI=1S/C19H15N5S/c1-2-4-13(5-3-1)19(16-11-20-12-25-16)7-6-14-15(10-19)23-24-17(14)18-21-8-9-22-18/h1-9,11-12H,10H2,(H,21,22)(H,23,24) |
| InChIKey | HRYPMDDRWAWAKN-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 70.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 345.43 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-[3-(1H-imidazol-2-yl)-6-phenyl-1,7-dihydroindazol-6-yl]-1,3-thiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[3-(1H-imidazol-2-yl)-6-phenyl-1,7-dihydroindazol-6-yl]-1,3-thiazole?
The IUPAC name of 5-[3-(1H-imidazol-2-yl)-6-phenyl-1,7-dihydroindazol-6-yl]-1,3-thiazole (CID 135761808) is 5-[3-(1H-imidazol-2-yl)-6-phenyl-1,7-dihydroindazol-6-yl]-1,3-thiazole.
What is the SMILES notation for 5-[3-(1H-imidazol-2-yl)-6-phenyl-1,7-dihydroindazol-6-yl]-1,3-thiazole?
The canonical SMILES for 5-[3-(1H-imidazol-2-yl)-6-phenyl-1,7-dihydroindazol-6-yl]-1,3-thiazole is C1=CC(c2ccccc2)(c2cncs2)Cc2[nH]nc(-c3ncc[nH]3)c21.
What is the InChIKey of 5-[3-(1H-imidazol-2-yl)-6-phenyl-1,7-dihydroindazol-6-yl]-1,3-thiazole?
The InChIKey is HRYPMDDRWAWAKN-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H15N5S/c1-2-4-13(5-3-1)19(16-11-20-12-25-16)7-6-14-15(10-19)23-24-17(14)18-21-8-9-22-18/h1-9,11-12H,10H2,(H,21,22)(H,23,24).
What are the key properties of 5-[3-(1H-imidazol-2-yl)-6-phenyl-1,7-dihydroindazol-6-yl]-1,3-thiazole?
5-[3-(1H-imidazol-2-yl)-6-phenyl-1,7-dihydroindazol-6-yl]-1,3-thiazole has a molecular weight of 345.43 g/mol, XLogP of 3.81, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[3-(1H-imidazol-2-yl)-6-phenyl-1,7-dihydroindazol-6-yl]-1,3-thiazole is sourced from PubChem (CID 135761808), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).