C21H21N3OS2 — CID 135761902
(E)-1-cyclobutyl-1-[6,6-di(thiophen-3-yl)-1,7-dihydroindazol-3-yl]-N-methoxymethanimine (PubChem CID 135761902) has the molecular formula C21H21N3OS2 and a molecular weight of 395.55 g/mol. Its IUPAC name is (E)-1-cyclobutyl-1-[6,6-di(thiophen-3-yl)-1,7-dihydroindazol-3-yl]-N-methoxymethanimine.
| Compound Name | (E)-1-cyclobutyl-1-[6,6-di(thiophen-3-yl)-1,7-dihydroindazol-3-yl]-N-methoxymethanimine |
|---|---|
| PubChem CID | 135761902 |
| Molecular Formula | C21H21N3OS2 |
| Molecular Weight | 395.55 g/mol |
| Exact Mass | 395.11 |
| IUPAC Name | (E)-1-cyclobutyl-1-[6,6-di(thiophen-3-yl)-1,7-dihydroindazol-3-yl]-N-methoxymethanimine |
| SMILES | CO/N=C(/c1n[nH]c2c1C=CC(c1ccsc1)(c1ccsc1)C2)C1CCC1 |
| InChI | InChI=1S/C21H21N3OS2/c1-25-24-19(14-3-2-4-14)20-17-5-8-21(11-18(17)22-23-20,15-6-9-26-12-15)16-7-10-27-13-16/h5-10,12-14H,2-4,11H2,1H3,(H,22,23)/b24-19+ |
| InChIKey | IEKKUVORVGLDDJ-LYBHJNIJSA-N |
| XLogP | 5.24 |
| TPSA | 50.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.55 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|