C13H22N6O — CID 135762369
1-(4-methyl-6-oxo-1H-pyrimidin-2-yl)-2-(2-piperidin-1-ylethyl)guanidine (PubChem CID 135762369) has the molecular formula C13H22N6O and a molecular weight of 278.36 g/mol. Its IUPAC name is 1-(4-methyl-6-oxo-1H-pyrimidin-2-yl)-2-(2-piperidin-1-ylethyl)guanidine.
| Compound Name | 1-(4-methyl-6-oxo-1H-pyrimidin-2-yl)-2-(2-piperidin-1-ylethyl)guanidine |
|---|---|
| PubChem CID | 135762369 |
| Molecular Formula | C13H22N6O |
| Molecular Weight | 278.36 g/mol |
| Exact Mass | 278.19 |
| IUPAC Name | 1-(4-methyl-6-oxo-1H-pyrimidin-2-yl)-2-(2-piperidin-1-ylethyl)guanidine |
| SMILES | Cc1cc(=O)[nH]c(N/C(N)=N/CCN2CCCCC2)n1 |
| InChI | InChI=1S/C13H22N6O/c1-10-9-11(20)17-13(16-10)18-12(14)15-5-8-19-6-3-2-4-7-19/h9H,2-8H2,1H3,(H4,14,15,16,17,18,20) |
| InChIKey | JGODCNYCEYRGSC-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 99.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.36 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|