About 4H-pyrrolo[3,2-f]quinazoline-1,3-diamine;hydrate
4H-pyrrolo[3,2-f]quinazoline-1,3-diamine;hydrate (PubChem CID 135762543) has the molecular formula C10H11N5O
and a molecular weight of 217.23 g/mol. Its IUPAC name is 4H-pyrrolo[3,2-f]quinazoline-1,3-diamine;hydrate.
Molecular Properties
| Compound Name | 4H-pyrrolo[3,2-f]quinazoline-1,3-diamine;hydrate |
| PubChem CID | 135762543 |
| Molecular Formula | C10H11N5O |
| Molecular Weight | 217.23 g/mol |
| Exact Mass | 217.10 |
| IUPAC Name | 4H-pyrrolo[3,2-f]quinazoline-1,3-diamine;hydrate |
| SMILES | Nc1nc(N)c2c(ccc3nccc32)[nH]1.O |
| InChI | InChI=1S/C10H9N5.H2O/c11-9-8-5-3-4-13-6(5)1-2-7(8)14-10(12)15-9;/h1-4H,11H2,(H3,12,14,15);1H2 |
| InChIKey | HDKNTQZGFXELDJ-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 125.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.23 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4H-pyrrolo[3,2-f]quinazoline-1,3-diamine;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4H-pyrrolo[3,2-f]quinazoline-1,3-diamine;hydrate?
The IUPAC name of 4H-pyrrolo[3,2-f]quinazoline-1,3-diamine;hydrate (CID 135762543) is 4H-pyrrolo[3,2-f]quinazoline-1,3-diamine;hydrate.
What is the SMILES notation for 4H-pyrrolo[3,2-f]quinazoline-1,3-diamine;hydrate?
The canonical SMILES for 4H-pyrrolo[3,2-f]quinazoline-1,3-diamine;hydrate is Nc1nc(N)c2c(ccc3nccc32)[nH]1.O.
What is the InChIKey of 4H-pyrrolo[3,2-f]quinazoline-1,3-diamine;hydrate?
The InChIKey is HDKNTQZGFXELDJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9N5.H2O/c11-9-8-5-3-4-13-6(5)1-2-7(8)14-10(12)15-9;/h1-4H,11H2,(H3,12,14,15);1H2.
What are the key properties of 4H-pyrrolo[3,2-f]quinazoline-1,3-diamine;hydrate?
4H-pyrrolo[3,2-f]quinazoline-1,3-diamine;hydrate has a molecular weight of 217.23 g/mol, XLogP of 0.45, 0 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4H-pyrrolo[3,2-f]quinazoline-1,3-diamine;hydrate is sourced from PubChem (CID 135762543), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).