About 2-amino-9-(1,5-dihydroxypentan-2-yl)-7,8-dihydro-1H-purin-6-one
2-amino-9-(1,5-dihydroxypentan-2-yl)-7,8-dihydro-1H-purin-6-one (PubChem CID 135763150) has the molecular formula C10H17N5O3
and a molecular weight of 255.28 g/mol. Its IUPAC name is 2-amino-9-(1,5-dihydroxypentan-2-yl)-7,8-dihydro-1H-purin-6-one.
Molecular Properties
| Compound Name | 2-amino-9-(1,5-dihydroxypentan-2-yl)-7,8-dihydro-1H-purin-6-one |
| PubChem CID | 135763150 |
| Molecular Formula | C10H17N5O3 |
| Molecular Weight | 255.28 g/mol |
| Exact Mass | 255.13 |
| IUPAC Name | 2-amino-9-(1,5-dihydroxypentan-2-yl)-7,8-dihydro-1H-purin-6-one |
| SMILES | Nc1nc2c(c(=O)[nH]1)NCN2C(CO)CCCO |
| InChI | InChI=1S/C10H17N5O3/c11-10-13-8-7(9(18)14-10)12-5-15(8)6(4-17)2-1-3-16/h6,12,16-17H,1-5H2,(H3,11,13,14,18) |
| InChIKey | SQGZBVGXWYJPTJ-UHFFFAOYSA-N |
| XLogP | -1.33 |
| TPSA | 127.50 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.28 |
| LogP ≤ 5 | -1.33 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 2-amino-9-(1,5-dihydroxypentan-2-yl)-7,8-dihydro-1H-purin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-9-(1,5-dihydroxypentan-2-yl)-7,8-dihydro-1H-purin-6-one?
The IUPAC name of 2-amino-9-(1,5-dihydroxypentan-2-yl)-7,8-dihydro-1H-purin-6-one (CID 135763150) is 2-amino-9-(1,5-dihydroxypentan-2-yl)-7,8-dihydro-1H-purin-6-one.
What is the SMILES notation for 2-amino-9-(1,5-dihydroxypentan-2-yl)-7,8-dihydro-1H-purin-6-one?
The canonical SMILES for 2-amino-9-(1,5-dihydroxypentan-2-yl)-7,8-dihydro-1H-purin-6-one is Nc1nc2c(c(=O)[nH]1)NCN2C(CO)CCCO.
What is the InChIKey of 2-amino-9-(1,5-dihydroxypentan-2-yl)-7,8-dihydro-1H-purin-6-one?
The InChIKey is SQGZBVGXWYJPTJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17N5O3/c11-10-13-8-7(9(18)14-10)12-5-15(8)6(4-17)2-1-3-16/h6,12,16-17H,1-5H2,(H3,11,13,14,18).
What are the key properties of 2-amino-9-(1,5-dihydroxypentan-2-yl)-7,8-dihydro-1H-purin-6-one?
2-amino-9-(1,5-dihydroxypentan-2-yl)-7,8-dihydro-1H-purin-6-one has a molecular weight of 255.28 g/mol, XLogP of -1.33, 5 rotatable bonds, 5 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-9-(1,5-dihydroxypentan-2-yl)-7,8-dihydro-1H-purin-6-one is sourced from PubChem (CID 135763150), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).