About 3-hydroxy-5-oxo-1,2-dihydropyrazole-4-carbaldehyde
3-hydroxy-5-oxo-1,2-dihydropyrazole-4-carbaldehyde (PubChem CID 135763221) has the molecular formula C4H4N2O3
and a molecular weight of 128.09 g/mol. Its IUPAC name is 3-hydroxy-5-oxo-1,2-dihydropyrazole-4-carbaldehyde.
Molecular Properties
| Compound Name | 3-hydroxy-5-oxo-1,2-dihydropyrazole-4-carbaldehyde |
| PubChem CID | 135763221 |
| Molecular Formula | C4H4N2O3 |
| Molecular Weight | 128.09 g/mol |
| Exact Mass | 128.02 |
| IUPAC Name | 3-hydroxy-5-oxo-1,2-dihydropyrazole-4-carbaldehyde |
| SMILES | O=Cc1c(O)[nH][nH]c1=O |
| InChI | InChI=1S/C4H4N2O3/c7-1-2-3(8)5-6-4(2)9/h1H,(H3,5,6,8,9) |
| InChIKey | FWLAABGFLUOKBQ-UHFFFAOYSA-N |
| XLogP | -0.78 |
| TPSA | 85.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 128.09 |
| LogP ≤ 5 | -0.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 3-hydroxy-5-oxo-1,2-dihydropyrazole-4-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-hydroxy-5-oxo-1,2-dihydropyrazole-4-carbaldehyde?
The IUPAC name of 3-hydroxy-5-oxo-1,2-dihydropyrazole-4-carbaldehyde (CID 135763221) is 3-hydroxy-5-oxo-1,2-dihydropyrazole-4-carbaldehyde.
What is the SMILES notation for 3-hydroxy-5-oxo-1,2-dihydropyrazole-4-carbaldehyde?
The canonical SMILES for 3-hydroxy-5-oxo-1,2-dihydropyrazole-4-carbaldehyde is O=Cc1c(O)[nH][nH]c1=O.
What is the InChIKey of 3-hydroxy-5-oxo-1,2-dihydropyrazole-4-carbaldehyde?
The InChIKey is FWLAABGFLUOKBQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H4N2O3/c7-1-2-3(8)5-6-4(2)9/h1H,(H3,5,6,8,9).
What are the key properties of 3-hydroxy-5-oxo-1,2-dihydropyrazole-4-carbaldehyde?
3-hydroxy-5-oxo-1,2-dihydropyrazole-4-carbaldehyde has a molecular weight of 128.09 g/mol, XLogP of -0.78, 1 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-hydroxy-5-oxo-1,2-dihydropyrazole-4-carbaldehyde is sourced from PubChem (CID 135763221), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).