C10H8FN3OS — CID 135764104
3-[(4-fluorophenyl)methylsulfanyl]-4H-1,2,4-triazin-5-one (PubChem CID 135764104) has the molecular formula C10H8FN3OS and a molecular weight of 237.26 g/mol. Its IUPAC name is 3-[(4-fluorophenyl)methylsulfanyl]-4H-1,2,4-triazin-5-one.
| Compound Name | 3-[(4-fluorophenyl)methylsulfanyl]-4H-1,2,4-triazin-5-one |
|---|---|
| PubChem CID | 135764104 |
| Molecular Formula | C10H8FN3OS |
| Molecular Weight | 237.26 g/mol |
| Exact Mass | 237.04 |
| IUPAC Name | 3-[(4-fluorophenyl)methylsulfanyl]-4H-1,2,4-triazin-5-one |
| SMILES | O=c1cnnc(SCc2ccc(F)cc2)[nH]1 |
| InChI | InChI=1S/C10H8FN3OS/c11-8-3-1-7(2-4-8)6-16-10-13-9(15)5-12-14-10/h1-5H,6H2,(H,13,14,15) |
| InChIKey | IKZXZMQRPNFTAX-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.26 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |