C15H19Br2N3O3S — CID 135765108
(NZ)-N-[[1-[3-(3-methylsulfonylpyridin-1-ium-1-yl)propyl]pyridin-1-ium-4-yl]methylidene]hydroxylamine dibromide (PubChem CID 135765108) has the molecular formula C15H19Br2N3O3S and a molecular weight of 481.21 g/mol. Its IUPAC name is (NZ)-N-[[1-[3-(3-methylsulfonylpyridin-1-ium-1-yl)propyl]pyridin-1-ium-4-yl]methylidene]hydroxylamine dibromide.
| Compound Name | (NZ)-N-[[1-[3-(3-methylsulfonylpyridin-1-ium-1-yl)propyl]pyridin-1-ium-4-yl]methylidene]hydroxylamine dibromide |
|---|---|
| PubChem CID | 135765108 |
| Molecular Formula | C15H19Br2N3O3S |
| Molecular Weight | 481.21 g/mol |
| Exact Mass | 478.95 |
| IUPAC Name | (NZ)-N-[[1-[3-(3-methylsulfonylpyridin-1-ium-1-yl)propyl]pyridin-1-ium-4-yl]methylidene]hydroxylamine dibromide |
| SMILES | CS(=O)(=O)c1ccc[n+](CCC[n+]2ccc(/C=N\O)cc2)c1.[Br-].[Br-] |
| InChI | InChI=1S/C15H18N3O3S.2BrH/c1-22(20,21)15-4-2-7-18(13-15)9-3-8-17-10-5-14(6-11-17)12-16-19;;/h2,4-7,10-13H,3,8-9H2,1H3;2*1H/q+1;;/p-1 |
| InChIKey | IXSWSUUPSSSUHY-UHFFFAOYSA-M |
| XLogP | -5.43 |
| TPSA | 74.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.21 |
| LogP ≤ 5 | -5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|