About 4-[(E)-(5-aminotetrazol-1-yl)iminomethyl]-2,6-dibromophenol
4-[(E)-(5-aminotetrazol-1-yl)iminomethyl]-2,6-dibromophenol (PubChem CID 135765559) has the molecular formula C8H6Br2N6O
and a molecular weight of 361.99 g/mol. Its IUPAC name is 4-[(E)-(5-aminotetrazol-1-yl)iminomethyl]-2,6-dibromophenol.
Molecular Properties
| Compound Name | 4-[(E)-(5-aminotetrazol-1-yl)iminomethyl]-2,6-dibromophenol |
| PubChem CID | 135765559 |
| Molecular Formula | C8H6Br2N6O |
| Molecular Weight | 361.99 g/mol |
| Exact Mass | 359.90 |
| IUPAC Name | 4-[(E)-(5-aminotetrazol-1-yl)iminomethyl]-2,6-dibromophenol |
| SMILES | Nc1nnnn1/N=C/c1cc(Br)c(O)c(Br)c1 |
| InChI | InChI=1S/C8H6Br2N6O/c9-5-1-4(2-6(10)7(5)17)3-12-16-8(11)13-14-15-16/h1-3,17H,(H2,11,13,15)/b12-3+ |
| InChIKey | RURYNVWYULHYCX-KGVSQERTSA-N |
| XLogP | 1.37 |
| TPSA | 102.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 361.99 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 4-[(E)-(5-aminotetrazol-1-yl)iminomethyl]-2,6-dibromophenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(E)-(5-aminotetrazol-1-yl)iminomethyl]-2,6-dibromophenol?
The IUPAC name of 4-[(E)-(5-aminotetrazol-1-yl)iminomethyl]-2,6-dibromophenol (CID 135765559) is 4-[(E)-(5-aminotetrazol-1-yl)iminomethyl]-2,6-dibromophenol.
What is the SMILES notation for 4-[(E)-(5-aminotetrazol-1-yl)iminomethyl]-2,6-dibromophenol?
The canonical SMILES for 4-[(E)-(5-aminotetrazol-1-yl)iminomethyl]-2,6-dibromophenol is Nc1nnnn1/N=C/c1cc(Br)c(O)c(Br)c1.
What is the InChIKey of 4-[(E)-(5-aminotetrazol-1-yl)iminomethyl]-2,6-dibromophenol?
The InChIKey is RURYNVWYULHYCX-KGVSQERTSA-N. The full InChI is InChI=1S/C8H6Br2N6O/c9-5-1-4(2-6(10)7(5)17)3-12-16-8(11)13-14-15-16/h1-3,17H,(H2,11,13,15)/b12-3+.
What are the key properties of 4-[(E)-(5-aminotetrazol-1-yl)iminomethyl]-2,6-dibromophenol?
4-[(E)-(5-aminotetrazol-1-yl)iminomethyl]-2,6-dibromophenol has a molecular weight of 361.99 g/mol, XLogP of 1.37, 2 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(E)-(5-aminotetrazol-1-yl)iminomethyl]-2,6-dibromophenol is sourced from PubChem (CID 135765559), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).