C19H15N2O5S- — CID 135765870
2-[[(5Z)-5-[(2,4-dimethoxyphenyl)methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoate (PubChem CID 135765870) has the molecular formula C19H15N2O5S- and a molecular weight of 383.41 g/mol. Its IUPAC name is 2-[[(5Z)-5-[(2,4-dimethoxyphenyl)methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoate.
| Compound Name | 2-[[(5Z)-5-[(2,4-dimethoxyphenyl)methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoate |
|---|---|
| PubChem CID | 135765870 |
| Molecular Formula | C19H15N2O5S- |
| Molecular Weight | 383.41 g/mol |
| Exact Mass | 383.07 |
| IUPAC Name | 2-[[(5Z)-5-[(2,4-dimethoxyphenyl)methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoate |
| SMILES | COc1ccc(/C=C2\S/C(=N/c3ccccc3C(=O)[O-])NC2=O)c(OC)c1 |
| InChI | InChI=1S/C19H16N2O5S/c1-25-12-8-7-11(15(10-12)26-2)9-16-17(22)21-19(27-16)20-14-6-4-3-5-13(14)18(23)24/h3-10H,1-2H3,(H,23,24)(H,20,21,22)/p-1/b16-9- |
| InChIKey | JQYVTLQFGMWOFN-SXGWCWSVSA-M |
| XLogP | 1.96 |
| TPSA | 100.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.41 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|