C12H13N3O5S — CID 135766471
[(2S)-1-amino-1-oxopropan-2-yl] 2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]acetate (PubChem CID 135766471) has the molecular formula C12H13N3O5S and a molecular weight of 311.32 g/mol. Its IUPAC name is [(2S)-1-amino-1-oxopropan-2-yl] 2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]acetate.
| Compound Name | [(2S)-1-amino-1-oxopropan-2-yl] 2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]acetate |
|---|---|
| PubChem CID | 135766471 |
| Molecular Formula | C12H13N3O5S |
| Molecular Weight | 311.32 g/mol |
| Exact Mass | 311.06 |
| IUPAC Name | [(2S)-1-amino-1-oxopropan-2-yl] 2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]acetate |
| SMILES | C[C@H](OC(=O)C/N=C1\NS(=O)(=O)c2ccccc21)C(N)=O |
| InChI | InChI=1S/C12H13N3O5S/c1-7(11(13)17)20-10(16)6-14-12-8-4-2-3-5-9(8)21(18,19)15-12/h2-5,7H,6H2,1H3,(H2,13,17)(H,14,15)/t7-/m0/s1 |
| InChIKey | SDRKJQZAQFJGDV-ZETCQYMHSA-N |
| XLogP | -0.86 |
| TPSA | 127.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.32 |
| LogP ≤ 5 | -0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|