C27H30N2O3 — CID 135768034
[(1S,3S)-1,2,2,3-tetramethylcyclopentyl]methyl 4-[(2-hydroxynaphthalen-1-yl)diazenyl]benzoate (PubChem CID 135768034) has the molecular formula C27H30N2O3 and a molecular weight of 430.55 g/mol. Its IUPAC name is [(1S,3S)-1,2,2,3-tetramethylcyclopentyl]methyl 4-[(2-hydroxynaphthalen-1-yl)diazenyl]benzoate.
| Compound Name | [(1S,3S)-1,2,2,3-tetramethylcyclopentyl]methyl 4-[(2-hydroxynaphthalen-1-yl)diazenyl]benzoate |
|---|---|
| PubChem CID | 135768034 |
| Molecular Formula | C27H30N2O3 |
| Molecular Weight | 430.55 g/mol |
| Exact Mass | 430.23 |
| IUPAC Name | [(1S,3S)-1,2,2,3-tetramethylcyclopentyl]methyl 4-[(2-hydroxynaphthalen-1-yl)diazenyl]benzoate |
| SMILES | C[C@H]1CC[C@](C)(COC(=O)c2ccc(/N=N/c3c(O)ccc4ccccc34)cc2)C1(C)C |
| InChI | InChI=1S/C27H30N2O3/c1-18-15-16-27(4,26(18,2)3)17-32-25(31)20-9-12-21(13-10-20)28-29-24-22-8-6-5-7-19(22)11-14-23(24)30/h5-14,18,30H,15-17H2,1-4H3/b29-28+/t18-,27+/m0/s1 |
| InChIKey | RXKGVUCNZGYOMG-JAIJFQQLSA-N |
| XLogP | 7.58 |
| TPSA | 71.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.55 |
| LogP ≤ 5 | 7.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|