C19H21N3O3S — CID 135768454
(5S)-5-(5-methylfuran-2-yl)-2-propylsulfanyl-3,5,7,8,9,10-hexahydropyrimido[4,5-b]quinoline-4,6-dione (PubChem CID 135768454) has the molecular formula C19H21N3O3S and a molecular weight of 371.46 g/mol. Its IUPAC name is (5S)-5-(5-methylfuran-2-yl)-2-propylsulfanyl-3,5,7,8,9,10-hexahydropyrimido[4,5-b]quinoline-4,6-dione.
| Compound Name | (5S)-5-(5-methylfuran-2-yl)-2-propylsulfanyl-3,5,7,8,9,10-hexahydropyrimido[4,5-b]quinoline-4,6-dione |
|---|---|
| PubChem CID | 135768454 |
| Molecular Formula | C19H21N3O3S |
| Molecular Weight | 371.46 g/mol |
| Exact Mass | 371.13 |
| IUPAC Name | (5S)-5-(5-methylfuran-2-yl)-2-propylsulfanyl-3,5,7,8,9,10-hexahydropyrimido[4,5-b]quinoline-4,6-dione |
| SMILES | CCCSc1nc2c(c(=O)[nH]1)[C@@H](c1ccc(C)o1)C1=C(CCCC1=O)N2 |
| InChI | InChI=1S/C19H21N3O3S/c1-3-9-26-19-21-17-16(18(24)22-19)15(13-8-7-10(2)25-13)14-11(20-17)5-4-6-12(14)23/h7-8,15H,3-6,9H2,1-2H3,(H2,20,21,22,24)/t15-/m0/s1 |
| InChIKey | GNZLCANYRUZGKN-HNNXBMFYSA-N |
| XLogP | 3.74 |
| TPSA | 87.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.46 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |