C22H16F2N6O4S — CID 135768541
11-(difluoromethyl)-4-[4-methoxy-3-[(4-nitropyrazol-1-yl)methyl]phenyl]-13-methyl-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,10,12-pentaen-6-one (PubChem CID 135768541) has the molecular formula C22H16F2N6O4S and a molecular weight of 498.47 g/mol. Its IUPAC name is 11-(difluoromethyl)-4-[4-methoxy-3-[(4-nitropyrazol-1-yl)methyl]phenyl]-13-methyl-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,10,12-pentaen-6-one.
| Compound Name | 11-(difluoromethyl)-4-[4-methoxy-3-[(4-nitropyrazol-1-yl)methyl]phenyl]-13-methyl-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,10,12-pentaen-6-one |
|---|---|
| PubChem CID | 135768541 |
| Molecular Formula | C22H16F2N6O4S |
| Molecular Weight | 498.47 g/mol |
| Exact Mass | 498.09 |
| IUPAC Name | 11-(difluoromethyl)-4-[4-methoxy-3-[(4-nitropyrazol-1-yl)methyl]phenyl]-13-methyl-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,10,12-pentaen-6-one |
| SMILES | COc1ccc(-c2nc3c(sc4nc(C(F)F)cc(C)c43)c(=O)[nH]2)cc1Cn1cc([N+](=O)[O-])cn1 |
| InChI | InChI=1S/C22H16F2N6O4S/c1-10-5-14(19(23)24)26-22-16(10)17-18(35-22)21(31)28-20(27-17)11-3-4-15(34-2)12(6-11)8-29-9-13(7-25-29)30(32)33/h3-7,9,19H,8H2,1-2H3,(H,27,28,31) |
| InChIKey | RYCMOZHZLJZKKT-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 128.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.47 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|