C32H48N6O4S — CID 135769496
2-[5-(4-cyclopentylpiperazin-1-yl)sulfonyl-2-ethoxyphenyl]-5-methyl-7-nonan-3-yl-3H-imidazo[5,1-f][1,2,4]triazin-4-one (PubChem CID 135769496) has the molecular formula C32H48N6O4S and a molecular weight of 612.84 g/mol. Its IUPAC name is 2-[5-(4-cyclopentylpiperazin-1-yl)sulfonyl-2-ethoxyphenyl]-5-methyl-7-nonan-3-yl-3H-imidazo[5,1-f][1,2,4]triazin-4-one.
| Compound Name | 2-[5-(4-cyclopentylpiperazin-1-yl)sulfonyl-2-ethoxyphenyl]-5-methyl-7-nonan-3-yl-3H-imidazo[5,1-f][1,2,4]triazin-4-one |
|---|---|
| PubChem CID | 135769496 |
| Molecular Formula | C32H48N6O4S |
| Molecular Weight | 612.84 g/mol |
| Exact Mass | 612.35 |
| IUPAC Name | 2-[5-(4-cyclopentylpiperazin-1-yl)sulfonyl-2-ethoxyphenyl]-5-methyl-7-nonan-3-yl-3H-imidazo[5,1-f][1,2,4]triazin-4-one |
| SMILES | CCCCCCC(CC)c1nc(C)c2c(=O)[nH]c(-c3cc(S(=O)(=O)N4CCN(C5CCCC5)CC4)ccc3OCC)nn12 |
| InChI | InChI=1S/C32H48N6O4S/c1-5-8-9-10-13-24(6-2)31-33-23(4)29-32(39)34-30(35-38(29)31)27-22-26(16-17-28(27)42-7-3)43(40,41)37-20-18-36(19-21-37)25-14-11-12-15-25/h16-17,22,24-25H,5-15,18-21H2,1-4H3,(H,34,35,39) |
| InChIKey | HTWSAMCYRLKRJL-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 112.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.84 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|