C22H17BrN4O3S — CID 135770094
N-[(E)-[5-(5-bromo-2-oxoindol-3-yl)-4-hydroxy-3-prop-2-enyl-1,3-thiazol-2-ylidene]amino]-2-phenylacetamide (PubChem CID 135770094) has the molecular formula C22H17BrN4O3S and a molecular weight of 497.37 g/mol. Its IUPAC name is N-[(E)-[5-(5-bromo-2-oxoindol-3-yl)-4-hydroxy-3-prop-2-enyl-1,3-thiazol-2-ylidene]amino]-2-phenylacetamide.
| Compound Name | N-[(E)-[5-(5-bromo-2-oxoindol-3-yl)-4-hydroxy-3-prop-2-enyl-1,3-thiazol-2-ylidene]amino]-2-phenylacetamide |
|---|---|
| PubChem CID | 135770094 |
| Molecular Formula | C22H17BrN4O3S |
| Molecular Weight | 497.37 g/mol |
| Exact Mass | 496.02 |
| IUPAC Name | N-[(E)-[5-(5-bromo-2-oxoindol-3-yl)-4-hydroxy-3-prop-2-enyl-1,3-thiazol-2-ylidene]amino]-2-phenylacetamide |
| SMILES | C=CCn1c(O)c(C2=c3cc(Br)ccc3=NC2=O)s/c1=N/NC(=O)Cc1ccccc1 |
| InChI | InChI=1S/C22H17BrN4O3S/c1-2-10-27-21(30)19(18-15-12-14(23)8-9-16(15)24-20(18)29)31-22(27)26-25-17(28)11-13-6-4-3-5-7-13/h2-9,12,30H,1,10-11H2,(H,25,28)/b26-22+ |
| InChIKey | HHRPTDOSOUCBMZ-XTCLZLMSSA-N |
| XLogP | 1.74 |
| TPSA | 96.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.37 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|