C11H16N3O2+ — CID 135770445
(NZ)-N-[[1-methyl-3-(pent-3-yn-2-yloxymethyl)imidazol-1-ium-2-yl]methylidene]hydroxylamine (PubChem CID 135770445) has the molecular formula C11H16N3O2+ and a molecular weight of 222.27 g/mol. Its IUPAC name is (NZ)-N-[[1-methyl-3-(pent-3-yn-2-yloxymethyl)imidazol-1-ium-2-yl]methylidene]hydroxylamine.
| Compound Name | (NZ)-N-[[1-methyl-3-(pent-3-yn-2-yloxymethyl)imidazol-1-ium-2-yl]methylidene]hydroxylamine |
|---|---|
| PubChem CID | 135770445 |
| Molecular Formula | C11H16N3O2+ |
| Molecular Weight | 222.27 g/mol |
| Exact Mass | 222.12 |
| IUPAC Name | (NZ)-N-[[1-methyl-3-(pent-3-yn-2-yloxymethyl)imidazol-1-ium-2-yl]methylidene]hydroxylamine |
| SMILES | CC#CC(C)OCn1cc[n+](C)c1/C=N\O |
| InChI | InChI=1S/C11H15N3O2/c1-4-5-10(2)16-9-14-7-6-13(3)11(14)8-12-15/h6-8,10H,9H2,1-3H3/p+1 |
| InChIKey | CZBKQGAZZJGKKI-UHFFFAOYSA-O |
| XLogP | 0.51 |
| TPSA | 50.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.27 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|