C15H12N4O4 — CID 135771128
N-[(7-hydroxy-3,6-dihydro-2H-[1,4]dioxino[2,3-f]indol-8-yl)imino]-1H-pyrrole-2-carboxamide (PubChem CID 135771128) has the molecular formula C15H12N4O4 and a molecular weight of 312.29 g/mol. Its IUPAC name is N-[(7-hydroxy-3,6-dihydro-2H-[1,4]dioxino[2,3-f]indol-8-yl)imino]-1H-pyrrole-2-carboxamide.
| Compound Name | N-[(7-hydroxy-3,6-dihydro-2H-[1,4]dioxino[2,3-f]indol-8-yl)imino]-1H-pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 135771128 |
| Molecular Formula | C15H12N4O4 |
| Molecular Weight | 312.29 g/mol |
| Exact Mass | 312.09 |
| IUPAC Name | N-[(7-hydroxy-3,6-dihydro-2H-[1,4]dioxino[2,3-f]indol-8-yl)imino]-1H-pyrrole-2-carboxamide |
| SMILES | O=C(/N=N/c1c(O)[nH]c2cc3c(cc12)OCCO3)c1ccc[nH]1 |
| InChI | InChI=1S/C15H12N4O4/c20-14(9-2-1-3-16-9)19-18-13-8-6-11-12(23-5-4-22-11)7-10(8)17-15(13)21/h1-3,6-7,16-17,21H,4-5H2/b19-18+ |
| InChIKey | JGOUKGQJPLSXFQ-VHEBQXMUSA-N |
| XLogP | 2.90 |
| TPSA | 112.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.29 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|