C23H26N4O4 — CID 135771832
2-methoxyethyl N-[(3S)-1-[2-(2-hydroxyphenyl)-7-methylquinazolin-4-yl]pyrrolidin-3-yl]carbamate (PubChem CID 135771832) has the molecular formula C23H26N4O4 and a molecular weight of 422.49 g/mol. Its IUPAC name is 2-methoxyethyl N-[(3S)-1-[2-(2-hydroxyphenyl)-7-methylquinazolin-4-yl]pyrrolidin-3-yl]carbamate.
| Compound Name | 2-methoxyethyl N-[(3S)-1-[2-(2-hydroxyphenyl)-7-methylquinazolin-4-yl]pyrrolidin-3-yl]carbamate |
|---|---|
| PubChem CID | 135771832 |
| Molecular Formula | C23H26N4O4 |
| Molecular Weight | 422.49 g/mol |
| Exact Mass | 422.20 |
| IUPAC Name | 2-methoxyethyl N-[(3S)-1-[2-(2-hydroxyphenyl)-7-methylquinazolin-4-yl]pyrrolidin-3-yl]carbamate |
| SMILES | COCCOC(=O)N[C@H]1CCN(c2nc(-c3ccccc3O)nc3cc(C)ccc23)C1 |
| InChI | InChI=1S/C23H26N4O4/c1-15-7-8-17-19(13-15)25-21(18-5-3-4-6-20(18)28)26-22(17)27-10-9-16(14-27)24-23(29)31-12-11-30-2/h3-8,13,16,28H,9-12,14H2,1-2H3,(H,24,29)/t16-/m0/s1 |
| InChIKey | LVTHEKSSFDAJMQ-INIZCTEOSA-N |
| XLogP | 3.26 |
| TPSA | 96.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.49 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|