C12H19N3OS — CID 135772126
(2Z)-2-[(E)-[(5R)-3,3,5-trimethylcyclohexylidene]hydrazinylidene]-1,3-thiazolidin-4-one (PubChem CID 135772126) has the molecular formula C12H19N3OS and a molecular weight of 253.37 g/mol. Its IUPAC name is (2Z)-2-[(E)-[(5R)-3,3,5-trimethylcyclohexylidene]hydrazinylidene]-1,3-thiazolidin-4-one.
| Compound Name | (2Z)-2-[(E)-[(5R)-3,3,5-trimethylcyclohexylidene]hydrazinylidene]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 135772126 |
| Molecular Formula | C12H19N3OS |
| Molecular Weight | 253.37 g/mol |
| Exact Mass | 253.12 |
| IUPAC Name | (2Z)-2-[(E)-[(5R)-3,3,5-trimethylcyclohexylidene]hydrazinylidene]-1,3-thiazolidin-4-one |
| SMILES | C[C@H]1C/C(=N\N=C2\NC(=O)CS2)CC(C)(C)C1 |
| InChI | InChI=1S/C12H19N3OS/c1-8-4-9(6-12(2,3)5-8)14-15-11-13-10(16)7-17-11/h8H,4-7H2,1-3H3,(H,13,15,16)/b14-9+/t8-/m0/s1 |
| InChIKey | GKIBALMFDWYXPK-UEFOHQGUSA-N |
| XLogP | 2.41 |
| TPSA | 53.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.37 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|