C16H12FN3O2 — CID 135772696
3-(3-fluoroanilino)-1,4-dihydroindeno[2,1-d]pyrazole-6,7-diol (PubChem CID 135772696) has the molecular formula C16H12FN3O2 and a molecular weight of 297.29 g/mol. Its IUPAC name is 3-(3-fluoroanilino)-1,4-dihydroindeno[2,1-d]pyrazole-6,7-diol.
| Compound Name | 3-(3-fluoroanilino)-1,4-dihydroindeno[2,1-d]pyrazole-6,7-diol |
|---|---|
| PubChem CID | 135772696 |
| Molecular Formula | C16H12FN3O2 |
| Molecular Weight | 297.29 g/mol |
| Exact Mass | 297.09 |
| IUPAC Name | 3-(3-fluoroanilino)-1,4-dihydroindeno[2,1-d]pyrazole-6,7-diol |
| SMILES | Oc1cc2c(cc1O)-c1[nH]nc(Nc3cccc(F)c3)c1C2 |
| InChI | InChI=1S/C16H12FN3O2/c17-9-2-1-3-10(6-9)18-16-12-4-8-5-13(21)14(22)7-11(8)15(12)19-20-16/h1-3,5-7,21-22H,4H2,(H2,18,19,20) |
| InChIKey | ZYZNSDOBZHQPNL-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 81.17 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.29 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|