About 3-butyl-4H-1,2,4-oxadiazol-5-one
3-butyl-4H-1,2,4-oxadiazol-5-one (PubChem CID 135773291) has the molecular formula C6H10N2O2
and a molecular weight of 142.16 g/mol. Its IUPAC name is 3-butyl-4H-1,2,4-oxadiazol-5-one.
Molecular Properties
| Compound Name | 3-butyl-4H-1,2,4-oxadiazol-5-one |
| PubChem CID | 135773291 |
| Molecular Formula | C6H10N2O2 |
| Molecular Weight | 142.16 g/mol |
| Exact Mass | 142.07 |
| IUPAC Name | 3-butyl-4H-1,2,4-oxadiazol-5-one |
| SMILES | CCCCc1noc(=O)[nH]1 |
| InChI | InChI=1S/C6H10N2O2/c1-2-3-4-5-7-6(9)10-8-5/h2-4H2,1H3,(H,7,8,9) |
| InChIKey | AJNDENVCZRTLHN-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 58.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 142.16 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-butyl-4H-1,2,4-oxadiazol-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-butyl-4H-1,2,4-oxadiazol-5-one?
The IUPAC name of 3-butyl-4H-1,2,4-oxadiazol-5-one (CID 135773291) is 3-butyl-4H-1,2,4-oxadiazol-5-one.
What is the SMILES notation for 3-butyl-4H-1,2,4-oxadiazol-5-one?
The canonical SMILES for 3-butyl-4H-1,2,4-oxadiazol-5-one is CCCCc1noc(=O)[nH]1.
What is the InChIKey of 3-butyl-4H-1,2,4-oxadiazol-5-one?
The InChIKey is AJNDENVCZRTLHN-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10N2O2/c1-2-3-4-5-7-6(9)10-8-5/h2-4H2,1H3,(H,7,8,9).
What are the key properties of 3-butyl-4H-1,2,4-oxadiazol-5-one?
3-butyl-4H-1,2,4-oxadiazol-5-one has a molecular weight of 142.16 g/mol, XLogP of 0.71, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-butyl-4H-1,2,4-oxadiazol-5-one is sourced from PubChem (CID 135773291), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).