C18H16N4O4S2 — CID 135773516
(2S)-2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-N-[(2-thiophen-2-yl-1,3-oxazol-4-yl)methyl]propanamide (PubChem CID 135773516) has the molecular formula C18H16N4O4S2 and a molecular weight of 416.48 g/mol. Its IUPAC name is (2S)-2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-N-[(2-thiophen-2-yl-1,3-oxazol-4-yl)methyl]propanamide.
| Compound Name | (2S)-2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-N-[(2-thiophen-2-yl-1,3-oxazol-4-yl)methyl]propanamide |
|---|---|
| PubChem CID | 135773516 |
| Molecular Formula | C18H16N4O4S2 |
| Molecular Weight | 416.48 g/mol |
| Exact Mass | 416.06 |
| IUPAC Name | (2S)-2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-N-[(2-thiophen-2-yl-1,3-oxazol-4-yl)methyl]propanamide |
| SMILES | C[C@H](/N=C1\NS(=O)(=O)c2ccccc21)C(=O)NCc1coc(-c2cccs2)n1 |
| InChI | InChI=1S/C18H16N4O4S2/c1-11(20-16-13-5-2-3-7-15(13)28(24,25)22-16)17(23)19-9-12-10-26-18(21-12)14-6-4-8-27-14/h2-8,10-11H,9H2,1H3,(H,19,23)(H,20,22)/t11-/m0/s1 |
| InChIKey | DJDMPKJLFFFRBL-NSHDSACASA-N |
| XLogP | 2.15 |
| TPSA | 113.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.48 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|