C8H11N5O3 — CID 135773671
(2E)-2-[(6-methyl-5-oxo-4H-1,2,4-triazin-3-yl)hydrazinylidene]butanoic acid (PubChem CID 135773671) has the molecular formula C8H11N5O3 and a molecular weight of 225.21 g/mol. Its IUPAC name is (2E)-2-[(6-methyl-5-oxo-4H-1,2,4-triazin-3-yl)hydrazinylidene]butanoic acid.
| Compound Name | (2E)-2-[(6-methyl-5-oxo-4H-1,2,4-triazin-3-yl)hydrazinylidene]butanoic acid |
|---|---|
| PubChem CID | 135773671 |
| Molecular Formula | C8H11N5O3 |
| Molecular Weight | 225.21 g/mol |
| Exact Mass | 225.09 |
| IUPAC Name | (2E)-2-[(6-methyl-5-oxo-4H-1,2,4-triazin-3-yl)hydrazinylidene]butanoic acid |
| SMILES | CC/C(=N\Nc1nnc(C)c(=O)[nH]1)C(=O)O |
| InChI | InChI=1S/C8H11N5O3/c1-3-5(7(15)16)11-13-8-9-6(14)4(2)10-12-8/h3H2,1-2H3,(H,15,16)(H2,9,12,13,14)/b11-5+ |
| InChIKey | XQOIZQYTZQWPLG-VZUCSPMQSA-N |
| XLogP | -0.26 |
| TPSA | 120.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.21 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|