C15H14N4O4S — CID 135773925
N-(3-nitrophenyl)-2-[(4-oxo-3,5,6,7-tetrahydrocyclopenta[d]pyrimidin-2-yl)sulfanyl]acetamide (PubChem CID 135773925) has the molecular formula C15H14N4O4S and a molecular weight of 346.37 g/mol. Its IUPAC name is N-(3-nitrophenyl)-2-[(4-oxo-3,5,6,7-tetrahydrocyclopenta[d]pyrimidin-2-yl)sulfanyl]acetamide.
| Compound Name | N-(3-nitrophenyl)-2-[(4-oxo-3,5,6,7-tetrahydrocyclopenta[d]pyrimidin-2-yl)sulfanyl]acetamide |
|---|---|
| PubChem CID | 135773925 |
| Molecular Formula | C15H14N4O4S |
| Molecular Weight | 346.37 g/mol |
| Exact Mass | 346.07 |
| IUPAC Name | N-(3-nitrophenyl)-2-[(4-oxo-3,5,6,7-tetrahydrocyclopenta[d]pyrimidin-2-yl)sulfanyl]acetamide |
| SMILES | O=C(CSc1nc2c(c(=O)[nH]1)CCC2)Nc1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C15H14N4O4S/c20-13(16-9-3-1-4-10(7-9)19(22)23)8-24-15-17-12-6-2-5-11(12)14(21)18-15/h1,3-4,7H,2,5-6,8H2,(H,16,20)(H,17,18,21) |
| InChIKey | SELSAYUQUMZEIS-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 117.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.37 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|